C19H16N2O3 — CID 13306003
2-(naphthalen-1-ylcarbamoylamino)-2-phenylacetic acid (PubChem CID 13306003) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-(naphthalen-1-ylcarbamoylamino)-2-phenylacetic acid.
| Compound Name | 2-(naphthalen-1-ylcarbamoylamino)-2-phenylacetic acid |
|---|---|
| PubChem CID | 13306003 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-(naphthalen-1-ylcarbamoylamino)-2-phenylacetic acid |
| SMILES | O=C(Nc1cccc2ccccc12)NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O3/c22-18(23)17(14-8-2-1-3-9-14)21-19(24)20-16-12-6-10-13-7-4-5-11-15(13)16/h1-12,17H,(H,22,23)(H2,20,21,24) |
| InChIKey | WMHWLAHNMGYKHN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |