C15H14N2O5 — CID 40606625
(2R)-2-(naphthalen-1-ylcarbamoylamino)butanedioic acid (PubChem CID 40606625) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is (2R)-2-(naphthalen-1-ylcarbamoylamino)butanedioic acid.
| Compound Name | (2R)-2-(naphthalen-1-ylcarbamoylamino)butanedioic acid |
|---|---|
| PubChem CID | 40606625 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (2R)-2-(naphthalen-1-ylcarbamoylamino)butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)Nc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H14N2O5/c18-13(19)8-12(14(20)21)17-15(22)16-11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12H,8H2,(H,18,19)(H,20,21)(H2,16,17,22)/t12-/m1/s1 |
| InChIKey | BKEZUXWHLDKFAS-GFCCVEGCSA-N |
| XLogP | 1.89 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |