C23H23N3O4 — CID 40571772
(2R)-2-[[(2R)-2-(naphthalen-1-ylcarbamoylamino)propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 40571772) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(naphthalen-1-ylcarbamoylamino)propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-(naphthalen-1-ylcarbamoylamino)propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 40571772 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (2R)-2-[[(2R)-2-(naphthalen-1-ylcarbamoylamino)propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | C[C@@H](NC(=O)Nc1cccc2ccccc12)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H23N3O4/c1-15(21(27)25-20(22(28)29)14-16-8-3-2-4-9-16)24-23(30)26-19-13-7-11-17-10-5-6-12-18(17)19/h2-13,15,20H,14H2,1H3,(H,25,27)(H,28,29)(H2,24,26,30)/t15-,20-/m1/s1 |
| InChIKey | JYEBKNONUNVENG-FOIQADDNSA-N |
| XLogP | 3.16 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |