C27H22Cl3N3OS — CID 2830339
2,2-diphenyl-N-[2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]acetamide (PubChem CID 2830339) has the molecular formula C27H22Cl3N3OS and a molecular weight of 542.92 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 2830339 |
| Molecular Formula | C27H22Cl3N3OS |
| Molecular Weight | 542.92 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 2,2-diphenyl-N-[2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]acetamide |
| SMILES | O=C(NC(NC(=S)Nc1cccc2ccccc12)C(Cl)(Cl)Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22Cl3N3OS/c28-27(29,30)25(33-26(35)31-22-17-9-15-18-10-7-8-16-21(18)22)32-24(34)23(19-11-3-1-4-12-19)20-13-5-2-6-14-20/h1-17,23,25H,(H,32,34)(H2,31,33,35) |
| InChIKey | MFPCCTLEXJFWIR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.92 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|