C20H15Cl3FN3OS — CID 1336851
4-fluoro-N-[(1S)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]benzamide (PubChem CID 1336851) has the molecular formula C20H15Cl3FN3OS and a molecular weight of 470.78 g/mol. Its IUPAC name is 4-fluoro-N-[(1S)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]benzamide.
| Compound Name | 4-fluoro-N-[(1S)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 1336851 |
| Molecular Formula | C20H15Cl3FN3OS |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 4-fluoro-N-[(1S)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]benzamide |
| SMILES | O=C(N[C@@H](NC(=S)Nc1cccc2ccccc12)C(Cl)(Cl)Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15Cl3FN3OS/c21-20(22,23)18(26-17(28)13-8-10-14(24)11-9-13)27-19(29)25-16-7-3-5-12-4-1-2-6-15(12)16/h1-11,18H,(H,26,28)(H2,25,27,29)/t18-/m0/s1 |
| InChIKey | YSAIGQGOQICIDY-SFHVURJKSA-N |
| XLogP | 5.39 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|