C20H15Cl3N4O3S — CID 1380099
3-nitro-N-[(1S)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]benzamide (PubChem CID 1380099) has the molecular formula C20H15Cl3N4O3S and a molecular weight of 497.79 g/mol. Its IUPAC name is 3-nitro-N-[(1S)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]benzamide.
| Compound Name | 3-nitro-N-[(1S)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 1380099 |
| Molecular Formula | C20H15Cl3N4O3S |
| Molecular Weight | 497.79 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 3-nitro-N-[(1S)-2,2,2-trichloro-1-(naphthalen-1-ylcarbamothioylamino)ethyl]benzamide |
| SMILES | O=C(N[C@@H](NC(=S)Nc1cccc2ccccc12)C(Cl)(Cl)Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H15Cl3N4O3S/c21-20(22,23)18(25-17(28)13-7-3-8-14(11-13)27(29)30)26-19(31)24-16-10-4-6-12-5-1-2-9-15(12)16/h1-11,18H,(H,25,28)(H2,24,26,31)/t18-/m0/s1 |
| InChIKey | IQVUTBMGOYXRPH-SFHVURJKSA-N |
| XLogP | 5.16 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.79 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|