C18H15Cl3FN3O3S — CID 2891775
methyl 2-[[2,2,2-trichloro-1-[(4-fluorobenzoyl)amino]ethyl]carbamothioylamino]benzoate (PubChem CID 2891775) has the molecular formula C18H15Cl3FN3O3S and a molecular weight of 478.76 g/mol. Its IUPAC name is methyl 2-[[2,2,2-trichloro-1-[(4-fluorobenzoyl)amino]ethyl]carbamothioylamino]benzoate.
| Compound Name | methyl 2-[[2,2,2-trichloro-1-[(4-fluorobenzoyl)amino]ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2891775 |
| Molecular Formula | C18H15Cl3FN3O3S |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | methyl 2-[[2,2,2-trichloro-1-[(4-fluorobenzoyl)amino]ethyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)NC(NC(=O)c1ccc(F)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H15Cl3FN3O3S/c1-28-15(27)12-4-2-3-5-13(12)23-17(29)25-16(18(19,20)21)24-14(26)10-6-8-11(22)9-7-10/h2-9,16H,1H3,(H,24,26)(H2,23,25,29) |
| InChIKey | RMZXYJYQGRJJEN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|