C20H22Cl3N3O5S — CID 2887204
3,4,5-trimethoxy-N-[2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 2887204) has the molecular formula C20H22Cl3N3O5S and a molecular weight of 522.84 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 2887204 |
| Molecular Formula | C20H22Cl3N3O5S |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | COc1ccccc1NC(=S)NC(NC(=O)c1cc(OC)c(OC)c(OC)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H22Cl3N3O5S/c1-28-13-8-6-5-7-12(13)24-19(32)26-18(20(21,22)23)25-17(27)11-9-14(29-2)16(31-4)15(10-11)30-3/h5-10,18H,1-4H3,(H,25,27)(H2,24,26,32) |
| InChIKey | WDKRZKQOEIFHPP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|