C13H14Cl3N3O2S — CID 5063371
N-[2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]prop-2-enamide (PubChem CID 5063371) has the molecular formula C13H14Cl3N3O2S and a molecular weight of 382.70 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]prop-2-enamide.
| Compound Name | N-[2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 5063371 |
| Molecular Formula | C13H14Cl3N3O2S |
| Molecular Weight | 382.70 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(2-methoxyphenyl)carbamothioylamino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(NC(=S)Nc1ccccc1OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H14Cl3N3O2S/c1-3-10(20)18-11(13(14,15)16)19-12(22)17-8-6-4-5-7-9(8)21-2/h3-7,11H,1H2,2H3,(H,18,20)(H2,17,19,22) |
| InChIKey | GLQGTXVETZXEKV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.70 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|