C19H19Cl4N3O3S — CID 1380668
2-(3,4-dimethoxyphenyl)-N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 1380668) has the molecular formula C19H19Cl4N3O3S and a molecular weight of 511.26 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 1380668 |
| Molecular Formula | C19H19Cl4N3O3S |
| Molecular Weight | 511.26 g/mol |
| Exact Mass | 508.99 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | COc1ccc(CC(=O)N[C@H](NC(=S)Nc2ccccc2Cl)C(Cl)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C19H19Cl4N3O3S/c1-28-14-8-7-11(9-15(14)29-2)10-16(27)25-17(19(21,22)23)26-18(30)24-13-6-4-3-5-12(13)20/h3-9,17H,10H2,1-2H3,(H,25,27)(H2,24,26,30)/t17-/m1/s1 |
| InChIKey | KMFYHURMFCYXNY-QGZVFWFLSA-N |
| XLogP | 4.70 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|