C13H15Cl4N3OS — CID 2830043
N-[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]butanamide (PubChem CID 2830043) has the molecular formula C13H15Cl4N3OS and a molecular weight of 403.16 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]butanamide.
| Compound Name | N-[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]butanamide |
|---|---|
| PubChem CID | 2830043 |
| Molecular Formula | C13H15Cl4N3OS |
| Molecular Weight | 403.16 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]butanamide |
| SMILES | CCCC(=O)NC(NC(=S)Nc1ccccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H15Cl4N3OS/c1-2-5-10(21)19-11(13(15,16)17)20-12(22)18-9-7-4-3-6-8(9)14/h3-4,6-7,11H,2,5H2,1H3,(H,19,21)(H2,18,20,22) |
| InChIKey | QCQQGAQGNJEKHU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.16 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|