C12H13BrCl3N3OS — CID 2906627
N-[1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]propanamide (PubChem CID 2906627) has the molecular formula C12H13BrCl3N3OS and a molecular weight of 433.59 g/mol. Its IUPAC name is N-[1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]propanamide.
| Compound Name | N-[1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]propanamide |
|---|---|
| PubChem CID | 2906627 |
| Molecular Formula | C12H13BrCl3N3OS |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 430.90 |
| IUPAC Name | N-[1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]propanamide |
| SMILES | CCC(=O)NC(NC(=S)Nc1ccccc1Br)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13BrCl3N3OS/c1-2-9(20)18-10(12(14,15)16)19-11(21)17-8-6-4-3-5-7(8)13/h3-6,10H,2H2,1H3,(H,18,20)(H2,17,19,21) |
| InChIKey | YLDDYSKNGPLWTF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|