C17H15BrCl3N3OS — CID 2887197
N-[1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-phenylacetamide (PubChem CID 2887197) has the molecular formula C17H15BrCl3N3OS and a molecular weight of 495.66 g/mol. Its IUPAC name is N-[1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-phenylacetamide.
| Compound Name | N-[1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 2887197 |
| Molecular Formula | C17H15BrCl3N3OS |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 492.92 |
| IUPAC Name | N-[1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(NC(=S)Nc1ccccc1Br)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H15BrCl3N3OS/c18-12-8-4-5-9-13(12)22-16(26)24-15(17(19,20)21)23-14(25)10-11-6-2-1-3-7-11/h1-9,15H,10H2,(H,23,25)(H2,22,24,26) |
| InChIKey | QCQWBUXUOOJRCB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|