C16H12BrCl3IN3OS — CID 98129831
N-[(1S)-1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-4-iodobenzamide (PubChem CID 98129831) has the molecular formula C16H12BrCl3IN3OS and a molecular weight of 607.53 g/mol. Its IUPAC name is N-[(1S)-1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-4-iodobenzamide.
| Compound Name | N-[(1S)-1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 98129831 |
| Molecular Formula | C16H12BrCl3IN3OS |
| Molecular Weight | 607.53 g/mol |
| Exact Mass | 604.80 |
| IUPAC Name | N-[(1S)-1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-4-iodobenzamide |
| SMILES | O=C(N[C@@H](NC(=S)Nc1ccccc1Br)C(Cl)(Cl)Cl)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H12BrCl3IN3OS/c17-11-3-1-2-4-12(11)22-15(26)24-14(16(18,19)20)23-13(25)9-5-7-10(21)8-6-9/h1-8,14H,(H,23,25)(H2,22,24,26)/t14-/m0/s1 |
| InChIKey | USLKBNROFQYKHT-AWEZNQCLSA-N |
| XLogP | 5.47 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|