C17H13BrCl5N3O2S — CID 98182940
N-[(1R)-1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 98182940) has the molecular formula C17H13BrCl5N3O2S and a molecular weight of 580.55 g/mol. Its IUPAC name is N-[(1R)-1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(1R)-1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 98182940 |
| Molecular Formula | C17H13BrCl5N3O2S |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 576.84 |
| IUPAC Name | N-[(1R)-1-[(2-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N[C@H](NC(=S)Nc1ccccc1Br)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H13BrCl5N3O2S/c18-10-3-1-2-4-12(10)24-16(29)26-15(17(21,22)23)25-14(27)8-28-13-6-5-9(19)7-11(13)20/h1-7,15H,8H2,(H,25,27)(H2,24,26,29)/t15-/m1/s1 |
| InChIKey | CGWMIUDXOOWTQG-OAHLLOKOSA-N |
| XLogP | 5.93 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|