C16H22Cl3N3OS — CID 18839265
N-[2,2,2-trichloro-1-[(2-ethylphenyl)carbamothioylamino]ethyl]pentanamide (PubChem CID 18839265) has the molecular formula C16H22Cl3N3OS and a molecular weight of 410.80 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(2-ethylphenyl)carbamothioylamino]ethyl]pentanamide.
| Compound Name | N-[2,2,2-trichloro-1-[(2-ethylphenyl)carbamothioylamino]ethyl]pentanamide |
|---|---|
| PubChem CID | 18839265 |
| Molecular Formula | C16H22Cl3N3OS |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(2-ethylphenyl)carbamothioylamino]ethyl]pentanamide |
| SMILES | CCCCC(=O)NC(NC(=S)Nc1ccccc1CC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H22Cl3N3OS/c1-3-5-10-13(23)21-14(16(17,18)19)22-15(24)20-12-9-7-6-8-11(12)4-2/h6-9,14H,3-5,10H2,1-2H3,(H,21,23)(H2,20,22,24) |
| InChIKey | LKXXUSKGDUACDK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|