C17H22Cl3N3O3S — CID 18839541
ethyl 2-[[2,2,2-trichloro-1-(pentanoylamino)ethyl]carbamothioylamino]benzoate (PubChem CID 18839541) has the molecular formula C17H22Cl3N3O3S and a molecular weight of 454.81 g/mol. Its IUPAC name is ethyl 2-[[2,2,2-trichloro-1-(pentanoylamino)ethyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 2-[[2,2,2-trichloro-1-(pentanoylamino)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 18839541 |
| Molecular Formula | C17H22Cl3N3O3S |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | ethyl 2-[[2,2,2-trichloro-1-(pentanoylamino)ethyl]carbamothioylamino]benzoate |
| SMILES | CCCCC(=O)NC(NC(=S)Nc1ccccc1C(=O)OCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H22Cl3N3O3S/c1-3-5-10-13(24)22-15(17(18,19)20)23-16(27)21-12-9-7-6-8-11(12)14(25)26-4-2/h6-9,15H,3-5,10H2,1-2H3,(H,22,24)(H2,21,23,27) |
| InChIKey | VWCYDZLWYHRKHO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|