C19H27Cl4N3OS — CID 98130387
N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]decanamide (PubChem CID 98130387) has the molecular formula C19H27Cl4N3OS and a molecular weight of 487.32 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]decanamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]decanamide |
|---|---|
| PubChem CID | 98130387 |
| Molecular Formula | C19H27Cl4N3OS |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@H](NC(=S)Nc1ccccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H27Cl4N3OS/c1-2-3-4-5-6-7-8-13-16(27)25-17(19(21,22)23)26-18(28)24-15-12-10-9-11-14(15)20/h9-12,17H,2-8,13H2,1H3,(H,25,27)(H2,24,26,28)/t17-/m1/s1 |
| InChIKey | JCWBZILDBPKZGA-QGZVFWFLSA-N |
| XLogP | 6.58 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|