C14H15Cl4N3O3S — CID 51056913
methyl 4-oxo-4-[[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]amino]butanoate (PubChem CID 51056913) has the molecular formula C14H15Cl4N3O3S and a molecular weight of 447.17 g/mol. Its IUPAC name is methyl 4-oxo-4-[[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]amino]butanoate.
| Compound Name | methyl 4-oxo-4-[[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]amino]butanoate |
|---|---|
| PubChem CID | 51056913 |
| Molecular Formula | C14H15Cl4N3O3S |
| Molecular Weight | 447.17 g/mol |
| Exact Mass | 444.96 |
| IUPAC Name | methyl 4-oxo-4-[[2,2,2-trichloro-1-[(2-chlorophenyl)carbamothioylamino]ethyl]amino]butanoate |
| SMILES | COC(=O)CCC(=O)NC(NC(=S)Nc1ccccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H15Cl4N3O3S/c1-24-11(23)7-6-10(22)20-12(14(16,17)18)21-13(25)19-9-5-3-2-4-8(9)15/h2-5,12H,6-7H2,1H3,(H,20,22)(H2,19,21,25) |
| InChIKey | ZVWMSXQGMNNXJR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|