C14H18Cl3N3OS — CID 2133219
N-[(1R)-2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]butanamide (PubChem CID 2133219) has the molecular formula C14H18Cl3N3OS and a molecular weight of 382.74 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]butanamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]butanamide |
|---|---|
| PubChem CID | 2133219 |
| Molecular Formula | C14H18Cl3N3OS |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]butanamide |
| SMILES | CCCC(=O)N[C@H](NC(=S)Nc1ccc(C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H18Cl3N3OS/c1-3-4-11(21)19-12(14(15,16)17)20-13(22)18-10-7-5-9(2)6-8-10/h5-8,12H,3-4H2,1-2H3,(H,19,21)(H2,18,20,22)/t12-/m1/s1 |
| InChIKey | RYIYENGENYFAHM-GFCCVEGCSA-N |
| XLogP | 3.89 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|