C20H22Cl3N3O2S — CID 4510849
2-(4-ethylphenoxy)-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 4510849) has the molecular formula C20H22Cl3N3O2S and a molecular weight of 474.84 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 4510849 |
| Molecular Formula | C20H22Cl3N3O2S |
| Molecular Weight | 474.84 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-[2,2,2-trichloro-1-[(4-methylphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)NC(NC(=S)Nc2ccc(C)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H22Cl3N3O2S/c1-3-14-6-10-16(11-7-14)28-12-17(27)25-18(20(21,22)23)26-19(29)24-15-8-4-13(2)5-9-15/h4-11,18H,3,12H2,1-2H3,(H,25,27)(H2,24,26,29) |
| InChIKey | BGKHWDONBSJMKD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|