C19H19Cl3FN3O2S — CID 2277382
2-(4-ethylphenoxy)-N-[(1S)-2,2,2-trichloro-1-[(4-fluorophenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 2277382) has the molecular formula C19H19Cl3FN3O2S and a molecular weight of 478.80 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-[(1S)-2,2,2-trichloro-1-[(4-fluorophenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-[(1S)-2,2,2-trichloro-1-[(4-fluorophenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 2277382 |
| Molecular Formula | C19H19Cl3FN3O2S |
| Molecular Weight | 478.80 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-[(1S)-2,2,2-trichloro-1-[(4-fluorophenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)N[C@@H](NC(=S)Nc2ccc(F)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H19Cl3FN3O2S/c1-2-12-3-9-15(10-4-12)28-11-16(27)25-17(19(20,21)22)26-18(29)24-14-7-5-13(23)6-8-14/h3-10,17H,2,11H2,1H3,(H,25,27)(H2,24,26,29)/t17-/m0/s1 |
| InChIKey | GYVOPPMKHJBIKX-KRWDZBQOSA-N |
| XLogP | 4.57 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.80 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|