C13H15Cl4N3O2S — CID 3626898
2-chloro-N-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 3626898) has the molecular formula C13H15Cl4N3O2S and a molecular weight of 419.16 g/mol. Its IUPAC name is 2-chloro-N-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 3626898 |
| Molecular Formula | C13H15Cl4N3O2S |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 2-chloro-N-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | CCOc1ccc(NC(=S)NC(NC(=O)CCl)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C13H15Cl4N3O2S/c1-2-22-9-5-3-8(4-6-9)18-12(23)20-11(13(15,16)17)19-10(21)7-14/h3-6,11H,2,7H2,1H3,(H,19,21)(H2,18,20,23) |
| InChIKey | FFAWIBUNMWBLKQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|