C14H19Cl3N4O2S — CID 2887248
1,1-dimethyl-3-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]urea (PubChem CID 2887248) has the molecular formula C14H19Cl3N4O2S and a molecular weight of 413.76 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]urea |
|---|---|
| PubChem CID | 2887248 |
| Molecular Formula | C14H19Cl3N4O2S |
| Molecular Weight | 413.76 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 1,1-dimethyl-3-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]urea |
| SMILES | CCOc1ccc(NC(=S)NC(NC(=O)N(C)C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H19Cl3N4O2S/c1-4-23-10-7-5-9(6-8-10)18-12(24)19-11(14(15,16)17)20-13(22)21(2)3/h5-8,11H,4H2,1-3H3,(H,20,22)(H2,18,19,24) |
| InChIKey | MFIMQMWOEDJOBC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.76 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|