C14H18BrCl3N4OS — CID 35580447
3-[(1R)-1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-1,1-diethylurea (PubChem CID 35580447) has the molecular formula C14H18BrCl3N4OS and a molecular weight of 476.66 g/mol. Its IUPAC name is 3-[(1R)-1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-1,1-diethylurea.
| Compound Name | 3-[(1R)-1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 35580447 |
| Molecular Formula | C14H18BrCl3N4OS |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 473.95 |
| IUPAC Name | 3-[(1R)-1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@H](NC(=S)Nc1ccc(Br)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H18BrCl3N4OS/c1-3-22(4-2)13(23)21-11(14(16,17)18)20-12(24)19-10-7-5-9(15)6-8-10/h5-8,11H,3-4H2,1-2H3,(H,21,23)(H2,19,20,24)/t11-/m0/s1 |
| InChIKey | QFECGTLWIBADAB-NSHDSACASA-N |
| XLogP | 4.48 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|