C12H13BrCl3N3O2S — CID 3269554
ethyl N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]carbamate (PubChem CID 3269554) has the molecular formula C12H13BrCl3N3O2S and a molecular weight of 449.59 g/mol. Its IUPAC name is ethyl N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]carbamate.
| Compound Name | ethyl N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]carbamate |
|---|---|
| PubChem CID | 3269554 |
| Molecular Formula | C12H13BrCl3N3O2S |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 446.90 |
| IUPAC Name | ethyl N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]carbamate |
| SMILES | CCOC(=O)NC(NC(=S)Nc1ccc(Br)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13BrCl3N3O2S/c1-2-21-11(20)19-9(12(14,15)16)18-10(22)17-8-5-3-7(13)4-6-8/h3-6,9H,2H2,1H3,(H,19,20)(H2,17,18,22) |
| InChIKey | WYZFCRINIZBSRU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|