C14H17BrCl3N3OS — CID 3993030
N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2,2-dimethylpropanamide (PubChem CID 3993030) has the molecular formula C14H17BrCl3N3OS and a molecular weight of 461.64 g/mol. Its IUPAC name is N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3993030 |
| Molecular Formula | C14H17BrCl3N3OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC(NC(=S)Nc1ccc(Br)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H17BrCl3N3OS/c1-13(2,3)11(22)20-10(14(16,17)18)21-12(23)19-9-6-4-8(15)5-7-9/h4-7,10H,1-3H3,(H,20,22)(H2,19,21,23) |
| InChIKey | VALZACBQGLZNNV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|