C17H22Cl3N3O4S — CID 2887330
butyl 4-[[2,2,2-trichloro-1-(ethoxycarbonylamino)ethyl]carbamothioylamino]benzoate (PubChem CID 2887330) has the molecular formula C17H22Cl3N3O4S and a molecular weight of 470.81 g/mol. Its IUPAC name is butyl 4-[[2,2,2-trichloro-1-(ethoxycarbonylamino)ethyl]carbamothioylamino]benzoate.
| Compound Name | butyl 4-[[2,2,2-trichloro-1-(ethoxycarbonylamino)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2887330 |
| Molecular Formula | C17H22Cl3N3O4S |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | butyl 4-[[2,2,2-trichloro-1-(ethoxycarbonylamino)ethyl]carbamothioylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=S)NC(NC(=O)OCC)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H22Cl3N3O4S/c1-3-5-10-27-13(24)11-6-8-12(9-7-11)21-15(28)22-14(17(18,19)20)23-16(25)26-4-2/h6-9,14H,3-5,10H2,1-2H3,(H,23,25)(H2,21,22,28) |
| InChIKey | FYECSWWWZGWJLW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|