C20H20Cl3N3O4S — CID 92844247
ethyl 4-[[(1R)-2,2,2-trichloro-1-[(2-methoxybenzoyl)amino]ethyl]carbamothioylamino]benzoate (PubChem CID 92844247) has the molecular formula C20H20Cl3N3O4S and a molecular weight of 504.82 g/mol. Its IUPAC name is ethyl 4-[[(1R)-2,2,2-trichloro-1-[(2-methoxybenzoyl)amino]ethyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[(1R)-2,2,2-trichloro-1-[(2-methoxybenzoyl)amino]ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 92844247 |
| Molecular Formula | C20H20Cl3N3O4S |
| Molecular Weight | 504.82 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | ethyl 4-[[(1R)-2,2,2-trichloro-1-[(2-methoxybenzoyl)amino]ethyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N[C@@H](NC(=O)c2ccccc2OC)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H20Cl3N3O4S/c1-3-30-17(28)12-8-10-13(11-9-12)24-19(31)26-18(20(21,22)23)25-16(27)14-6-4-5-7-15(14)29-2/h4-11,18H,3H2,1-2H3,(H,25,27)(H2,24,26,31)/t18-/m1/s1 |
| InChIKey | PCNRERDLFIYHAC-GOSISDBHSA-N |
| XLogP | 4.28 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.82 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|