C21H24N2O4S — CID 4945828
ethyl 4-[[2-(2-methylpropoxy)benzoyl]carbamothioylamino]benzoate (PubChem CID 4945828) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is ethyl 4-[[2-(2-methylpropoxy)benzoyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[2-(2-methylpropoxy)benzoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4945828 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | ethyl 4-[[2-(2-methylpropoxy)benzoyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC(=O)c2ccccc2OCC(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-4-26-20(25)15-9-11-16(12-10-15)22-21(28)23-19(24)17-7-5-6-8-18(17)27-13-14(2)3/h5-12,14H,4,13H2,1-3H3,(H2,22,23,24,28) |
| InChIKey | BNMOLGKYMYCWAQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|