C21H24N2O5S — CID 17355916
propyl 4-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]benzoate (PubChem CID 17355916) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is propyl 4-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]benzoate.
| Compound Name | propyl 4-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17355916 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | propyl 4-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=S)NC(=O)c2ccccc2OCCOC)cc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-3-12-28-20(25)15-8-10-16(11-9-15)22-21(29)23-19(24)17-6-4-5-7-18(17)27-14-13-26-2/h4-11H,3,12-14H2,1-2H3,(H2,22,23,24,29) |
| InChIKey | VGKNPQVIENVURR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|