C25H25N3O3S — CID 28640124
N-[[4-(benzylcarbamoyl)phenyl]carbamothioyl]-2-propoxybenzamide (PubChem CID 28640124) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[[4-(benzylcarbamoyl)phenyl]carbamothioyl]-2-propoxybenzamide.
| Compound Name | N-[[4-(benzylcarbamoyl)phenyl]carbamothioyl]-2-propoxybenzamide |
|---|---|
| PubChem CID | 28640124 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[[4-(benzylcarbamoyl)phenyl]carbamothioyl]-2-propoxybenzamide |
| SMILES | CCCOc1ccccc1C(=O)NC(=S)Nc1ccc(C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-2-16-31-22-11-7-6-10-21(22)24(30)28-25(32)27-20-14-12-19(13-15-20)23(29)26-17-18-8-4-3-5-9-18/h3-15H,2,16-17H2,1H3,(H,26,29)(H2,27,28,30,32) |
| InChIKey | QYSGLFOILDDCJU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|