C26H36N4O3S — CID 17230051
N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-2-pentoxybenzamide (PubChem CID 17230051) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-2-pentoxybenzamide.
| Compound Name | N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-2-pentoxybenzamide |
|---|---|
| PubChem CID | 17230051 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-2-pentoxybenzamide |
| SMILES | CCCCCOc1ccccc1C(=O)NC(=S)Nc1ccc(C(=O)NCCN(CC)CC)cc1 |
| InChI | InChI=1S/C26H36N4O3S/c1-4-7-10-19-33-23-12-9-8-11-22(23)25(32)29-26(34)28-21-15-13-20(14-16-21)24(31)27-17-18-30(5-2)6-3/h8-9,11-16H,4-7,10,17-19H2,1-3H3,(H,27,31)(H2,28,29,32,34) |
| InChIKey | SBNHSHNSHJSHNY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|