C27H38N4O3S — CID 17230048
N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-2-hexoxybenzamide (PubChem CID 17230048) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-2-hexoxybenzamide.
| Compound Name | N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17230048 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | N-[[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)NC(=S)Nc1ccc(C(=O)NCCN(CC)CC)cc1 |
| InChI | InChI=1S/C27H38N4O3S/c1-4-7-8-11-20-34-24-13-10-9-12-23(24)26(33)30-27(35)29-22-16-14-21(15-17-22)25(32)28-18-19-31(5-2)6-3/h9-10,12-17H,4-8,11,18-20H2,1-3H3,(H,28,32)(H2,29,30,33,35) |
| InChIKey | KHDASYDPCGLESA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|