C25H25N3O4S — CID 28639081
N-[[3-(benzylcarbamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 28639081) has the molecular formula C25H25N3O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[[3-(benzylcarbamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | N-[[3-(benzylcarbamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 28639081 |
| Molecular Formula | C25H25N3O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-[[3-(benzylcarbamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccccc1C(=O)NC(=S)Nc1cccc(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C25H25N3O4S/c1-31-14-15-32-22-13-6-5-12-21(22)24(30)28-25(33)27-20-11-7-10-19(16-20)23(29)26-17-18-8-3-2-4-9-18/h2-13,16H,14-15,17H2,1H3,(H,26,29)(H2,27,28,30,33) |
| InChIKey | DSWMGXGAUUGVSN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|