C22H21N3O5S — CID 26169334
N-[3-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide (PubChem CID 26169334) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[3-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26169334 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[3-[[2-(2-methoxyethoxy)benzoyl]carbamothioylamino]phenyl]furan-2-carboxamide |
| SMILES | COCCOc1ccccc1C(=O)NC(=S)Nc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C22H21N3O5S/c1-28-12-13-30-18-9-3-2-8-17(18)20(26)25-22(31)24-16-7-4-6-15(14-16)23-21(27)19-10-5-11-29-19/h2-11,14H,12-13H2,1H3,(H,23,27)(H2,24,25,26,31) |
| InChIKey | IOOPCBIEECEBTC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|