C23H26Cl3N3O5S — CID 4560745
butyl 4-[[2,2,2-trichloro-1-[(3,4-dimethoxybenzoyl)amino]ethyl]carbamothioylamino]benzoate (PubChem CID 4560745) has the molecular formula C23H26Cl3N3O5S and a molecular weight of 562.90 g/mol. Its IUPAC name is butyl 4-[[2,2,2-trichloro-1-[(3,4-dimethoxybenzoyl)amino]ethyl]carbamothioylamino]benzoate.
| Compound Name | butyl 4-[[2,2,2-trichloro-1-[(3,4-dimethoxybenzoyl)amino]ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4560745 |
| Molecular Formula | C23H26Cl3N3O5S |
| Molecular Weight | 562.90 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | butyl 4-[[2,2,2-trichloro-1-[(3,4-dimethoxybenzoyl)amino]ethyl]carbamothioylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=S)NC(NC(=O)c2ccc(OC)c(OC)c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C23H26Cl3N3O5S/c1-4-5-12-34-20(31)14-6-9-16(10-7-14)27-22(35)29-21(23(24,25)26)28-19(30)15-8-11-17(32-2)18(13-15)33-3/h6-11,13,21H,4-5,12H2,1-3H3,(H,28,30)(H2,27,29,35) |
| InChIKey | NXJLXCHNTHLMOC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|