C21H22Cl3N3O5S — CID 2887322
N-[1-[(4-acetylphenyl)carbamothioylamino]-2,2,2-trichloroethyl]-3,4,5-trimethoxybenzamide (PubChem CID 2887322) has the molecular formula C21H22Cl3N3O5S and a molecular weight of 534.85 g/mol. Its IUPAC name is N-[1-[(4-acetylphenyl)carbamothioylamino]-2,2,2-trichloroethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-[(4-acetylphenyl)carbamothioylamino]-2,2,2-trichloroethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2887322 |
| Molecular Formula | C21H22Cl3N3O5S |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | N-[1-[(4-acetylphenyl)carbamothioylamino]-2,2,2-trichloroethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(NC(=S)Nc2ccc(C(C)=O)cc2)C(Cl)(Cl)Cl)cc(OC)c1OC |
| InChI | InChI=1S/C21H22Cl3N3O5S/c1-11(28)12-5-7-14(8-6-12)25-20(33)27-19(21(22,23)24)26-18(29)13-9-15(30-2)17(32-4)16(10-13)31-3/h5-10,19H,1-4H3,(H,26,29)(H2,25,27,33) |
| InChIKey | SQGHXZYTJWAUBM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|