C20H20Br2Cl3N3O4S — CID 99662321
3,4,5-trimethoxy-N-[(1S)-2,2,2-trichloro-1-[(2,4-dibromo-5-methylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 99662321) has the molecular formula C20H20Br2Cl3N3O4S and a molecular weight of 664.63 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(1S)-2,2,2-trichloro-1-[(2,4-dibromo-5-methylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(1S)-2,2,2-trichloro-1-[(2,4-dibromo-5-methylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 99662321 |
| Molecular Formula | C20H20Br2Cl3N3O4S |
| Molecular Weight | 664.63 g/mol |
| Exact Mass | 660.86 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(1S)-2,2,2-trichloro-1-[(2,4-dibromo-5-methylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | COc1cc(C(=O)N[C@@H](NC(=S)Nc2cc(C)c(Br)cc2Br)C(Cl)(Cl)Cl)cc(OC)c1OC |
| InChI | InChI=1S/C20H20Br2Cl3N3O4S/c1-9-5-13(12(22)8-11(9)21)26-19(33)28-18(20(23,24)25)27-17(29)10-6-14(30-2)16(32-4)15(7-10)31-3/h5-8,18H,1-4H3,(H,27,29)(H2,26,28,33)/t18-/m0/s1 |
| InChIKey | XEDWFHDCXWZWHB-SFHVURJKSA-N |
| XLogP | 5.96 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|