C17H13Br3Cl3N3OS — CID 99662280
4-bromo-N-[(1R)-2,2,2-trichloro-1-[(2,4-dibromo-6-methylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 99662280) has the molecular formula C17H13Br3Cl3N3OS and a molecular weight of 653.45 g/mol. Its IUPAC name is 4-bromo-N-[(1R)-2,2,2-trichloro-1-[(2,4-dibromo-6-methylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[(1R)-2,2,2-trichloro-1-[(2,4-dibromo-6-methylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 99662280 |
| Molecular Formula | C17H13Br3Cl3N3OS |
| Molecular Weight | 653.45 g/mol |
| Exact Mass | 648.74 |
| IUPAC Name | 4-bromo-N-[(1R)-2,2,2-trichloro-1-[(2,4-dibromo-6-methylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1cc(Br)cc(Br)c1NC(=S)N[C@@H](NC(=O)c1ccc(Br)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H13Br3Cl3N3OS/c1-8-6-11(19)7-12(20)13(8)24-16(28)26-15(17(21,22)23)25-14(27)9-2-4-10(18)5-3-9/h2-7,15H,1H3,(H,25,27)(H2,24,26,28)/t15-/m1/s1 |
| InChIKey | WGFNOZRQEJEJHX-OAHLLOKOSA-N |
| XLogP | 6.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.45 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|