C12H10BrCl3N6OS — CID 2302843
4-bromo-N-[(1S)-2,2,2-trichloro-1-(1H-1,2,4-triazol-5-ylcarbamothioylamino)ethyl]benzamide (PubChem CID 2302843) has the molecular formula C12H10BrCl3N6OS and a molecular weight of 472.58 g/mol. Its IUPAC name is 4-bromo-N-[(1S)-2,2,2-trichloro-1-(1H-1,2,4-triazol-5-ylcarbamothioylamino)ethyl]benzamide.
| Compound Name | 4-bromo-N-[(1S)-2,2,2-trichloro-1-(1H-1,2,4-triazol-5-ylcarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 2302843 |
| Molecular Formula | C12H10BrCl3N6OS |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 469.89 |
| IUPAC Name | 4-bromo-N-[(1S)-2,2,2-trichloro-1-(1H-1,2,4-triazol-5-ylcarbamothioylamino)ethyl]benzamide |
| SMILES | O=C(N[C@@H](NC(=S)Nc1ncn[nH]1)C(Cl)(Cl)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H10BrCl3N6OS/c13-7-3-1-6(2-4-7)8(23)19-9(12(14,15)16)20-11(24)21-10-17-5-18-22-10/h1-5,9H,(H,19,23)(H3,17,18,20,21,22,24)/t9-/m0/s1 |
| InChIKey | VAYRHKMCBCLPSP-VIFPVBQESA-N |
| XLogP | 2.98 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|