C14H18Cl3N3O3S — CID 2268669
ethyl N-[(1S)-2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]carbamate (PubChem CID 2268669) has the molecular formula C14H18Cl3N3O3S and a molecular weight of 414.74 g/mol. Its IUPAC name is ethyl N-[(1S)-2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | ethyl N-[(1S)-2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 2268669 |
| Molecular Formula | C14H18Cl3N3O3S |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | ethyl N-[(1S)-2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]carbamate |
| SMILES | CCOC(=O)N[C@@H](NC(=S)Nc1ccc(OCC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H18Cl3N3O3S/c1-3-22-10-7-5-9(6-8-10)18-12(24)19-11(14(15,16)17)20-13(21)23-4-2/h5-8,11H,3-4H2,1-2H3,(H,20,21)(H2,18,19,24)/t11-/m1/s1 |
| InChIKey | KSUZFVDURMEBRW-LLVKDONJSA-N |
| XLogP | 3.81 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|