C18H17BrCl3N3O2S — CID 4551667
3-bromo-N-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 4551667) has the molecular formula C18H17BrCl3N3O2S and a molecular weight of 525.68 g/mol. Its IUPAC name is 3-bromo-N-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-bromo-N-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 4551667 |
| Molecular Formula | C18H17BrCl3N3O2S |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 522.93 |
| IUPAC Name | 3-bromo-N-[2,2,2-trichloro-1-[(4-ethoxyphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | CCOc1ccc(NC(=S)NC(NC(=O)c2cccc(Br)c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C18H17BrCl3N3O2S/c1-2-27-14-8-6-13(7-9-14)23-17(28)25-16(18(20,21)22)24-15(26)11-4-3-5-12(19)10-11/h3-10,16H,2H2,1H3,(H,24,26)(H2,23,25,28) |
| InChIKey | KRKPMHORARJQLR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|