C19H20Cl3N3O4S — CID 51681752
2-(4-methoxyphenoxy)-N-[(1S)-2,2,2-trichloro-1-[(4-methoxyphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 51681752) has the molecular formula C19H20Cl3N3O4S and a molecular weight of 492.81 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[(1S)-2,2,2-trichloro-1-[(4-methoxyphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[(1S)-2,2,2-trichloro-1-[(4-methoxyphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 51681752 |
| Molecular Formula | C19H20Cl3N3O4S |
| Molecular Weight | 492.81 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[(1S)-2,2,2-trichloro-1-[(4-methoxyphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | COc1ccc(NC(=S)N[C@H](NC(=O)COc2ccc(OC)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H20Cl3N3O4S/c1-27-13-5-3-12(4-6-13)23-18(30)25-17(19(20,21)22)24-16(26)11-29-15-9-7-14(28-2)8-10-15/h3-10,17H,11H2,1-2H3,(H,24,26)(H2,23,25,30)/t17-/m0/s1 |
| InChIKey | FJKAKLZBIMOXSP-KRWDZBQOSA-N |
| XLogP | 3.88 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|