C15H19Cl3N4O3S — CID 35580485
4-[[(1R)-2,2,2-trichloro-1-(diethylcarbamoylamino)ethyl]carbamothioylamino]benzoic acid (PubChem CID 35580485) has the molecular formula C15H19Cl3N4O3S and a molecular weight of 441.77 g/mol. Its IUPAC name is 4-[[(1R)-2,2,2-trichloro-1-(diethylcarbamoylamino)ethyl]carbamothioylamino]benzoic acid.
| Compound Name | 4-[[(1R)-2,2,2-trichloro-1-(diethylcarbamoylamino)ethyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 35580485 |
| Molecular Formula | C15H19Cl3N4O3S |
| Molecular Weight | 441.77 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 4-[[(1R)-2,2,2-trichloro-1-(diethylcarbamoylamino)ethyl]carbamothioylamino]benzoic acid |
| SMILES | CCN(CC)C(=O)N[C@H](NC(=S)Nc1ccc(C(=O)O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H19Cl3N4O3S/c1-3-22(4-2)14(25)21-12(15(16,17)18)20-13(26)19-10-7-5-9(6-8-10)11(23)24/h5-8,12H,3-4H2,1-2H3,(H,21,25)(H,23,24)(H2,19,20,26)/t12-/m0/s1 |
| InChIKey | YQFIFGUMFINRLM-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|