C14H15Cl3N3O3S- — CID 3711416
4-[[2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]carbamothioylamino]benzoate (PubChem CID 3711416) has the molecular formula C14H15Cl3N3O3S- and a molecular weight of 411.72 g/mol. Its IUPAC name is 4-[[2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]carbamothioylamino]benzoate.
| Compound Name | 4-[[2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 3711416 |
| Molecular Formula | C14H15Cl3N3O3S- |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 4-[[2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]carbamothioylamino]benzoate |
| SMILES | CC(C)C(=O)NC(NC(=S)Nc1ccc(C(=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H16Cl3N3O3S/c1-7(2)10(21)19-12(14(15,16)17)20-13(24)18-9-5-3-8(4-6-9)11(22)23/h3-7,12H,1-2H3,(H,19,21)(H,22,23)(H2,18,20,24)/p-1 |
| InChIKey | PPTQMIQRBWOHHQ-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|