C12H14Cl4N4OS — CID 40510260
2-methyl-N-[(1S)-2,2,2-trichloro-1-[(5-chloro-2-pyridinyl)carbamothioylamino]ethyl]propanamide (PubChem CID 40510260) has the molecular formula C12H14Cl4N4OS and a molecular weight of 404.15 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-2,2,2-trichloro-1-[(5-chloro-2-pyridinyl)carbamothioylamino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-[(5-chloro-2-pyridinyl)carbamothioylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 40510260 |
| Molecular Formula | C12H14Cl4N4OS |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-[(5-chloro-2-pyridinyl)carbamothioylamino]ethyl]propanamide |
| SMILES | CC(C)C(=O)N[C@@H](NC(=S)Nc1ccc(Cl)cn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H14Cl4N4OS/c1-6(2)9(21)19-10(12(14,15)16)20-11(22)18-8-4-3-7(13)5-17-8/h3-6,10H,1-2H3,(H,19,21)(H2,17,18,20,22)/t10-/m0/s1 |
| InChIKey | NUYVCYULKBUANS-JTQLQIEISA-N |
| XLogP | 3.49 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|