C16H17Cl3N4OS — CID 2830528
2-methyl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]propanamide (PubChem CID 2830528) has the molecular formula C16H17Cl3N4OS and a molecular weight of 419.77 g/mol. Its IUPAC name is 2-methyl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]propanamide.
| Compound Name | 2-methyl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 2830528 |
| Molecular Formula | C16H17Cl3N4OS |
| Molecular Weight | 419.77 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 2-methyl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]propanamide |
| SMILES | CC(C)C(=O)NC(NC(=S)Nc1cccc2cccnc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H17Cl3N4OS/c1-9(2)13(24)22-14(16(17,18)19)23-15(25)21-11-7-3-5-10-6-4-8-20-12(10)11/h3-9,14H,1-2H3,(H,22,24)(H2,21,23,25) |
| InChIKey | VNSZCCNYBOWQMW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|