C25H26Cl3N5OS — CID 139519224
3-phenyl-3-pyrrolidin-1-yl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]propanamide (PubChem CID 139519224) has the molecular formula C25H26Cl3N5OS and a molecular weight of 550.94 g/mol. Its IUPAC name is 3-phenyl-3-pyrrolidin-1-yl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]propanamide.
| Compound Name | 3-phenyl-3-pyrrolidin-1-yl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 139519224 |
| Molecular Formula | C25H26Cl3N5OS |
| Molecular Weight | 550.94 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 3-phenyl-3-pyrrolidin-1-yl-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]propanamide |
| SMILES | O=C(CC(c1ccccc1)N1CCCC1)NC(NC(=S)Nc1cccc2cccnc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H26Cl3N5OS/c26-25(27,28)23(32-24(35)30-19-12-6-10-18-11-7-13-29-22(18)19)31-21(34)16-20(33-14-4-5-15-33)17-8-2-1-3-9-17/h1-3,6-13,20,23H,4-5,14-16H2,(H,31,34)(H2,30,32,35) |
| InChIKey | FOQPJJUCWJIFIR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.94 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|