C20H17Cl3N4OS — CID 1380207
2-methyl-N-[(1R)-2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]benzamide (PubChem CID 1380207) has the molecular formula C20H17Cl3N4OS and a molecular weight of 467.81 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]benzamide.
| Compound Name | 2-methyl-N-[(1R)-2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 1380207 |
| Molecular Formula | C20H17Cl3N4OS |
| Molecular Weight | 467.81 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 2-methyl-N-[(1R)-2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H](NC(=S)Nc1cccc2cccnc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H17Cl3N4OS/c1-12-6-2-3-9-14(12)17(28)26-18(20(21,22)23)27-19(29)25-15-10-4-7-13-8-5-11-24-16(13)15/h2-11,18H,1H3,(H,26,28)(H2,25,27,29)/t18-/m1/s1 |
| InChIKey | ZLJGEPUKEMFEPN-GOSISDBHSA-N |
| XLogP | 4.96 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.81 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|